ChemNet > CAS > 305381-67-3 1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid
305381-67-3 1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid
| Ürün Adı |
1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid |
| Eş anlamlı |
1-methyl-1H-benzotriazole-5-carboxylic acid |
| Moleküler Formülü |
C8H7N3O2 |
| Molekül Ağırlığı |
177.1601 |
| InChI |
InChI=1/C8H7N3O2/c1-11-7-3-2-5(8(12)13)4-6(7)9-10-11/h2-4H,1H3,(H,12,13) |
| CAS kayıt numarası |
305381-67-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.49g/cm3 |
| Ergime noktası |
269℃ |
| Kaynama noktası |
432.4°C at 760 mmHg |
| Kırılma indisi |
1.704 |
| Alevlenme noktası |
215.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
